CAS 1280225-89-9 appears in our catalog under these names: 1-(Acetyl-d3)adamantane, 1-(Adamantan-1-yl)ethan-1-one-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10 mg, 25 mg, 5 mg.
1-(1-adamantyl)-2,2,2-trideuterioethanone (CAS 1280225-89-9) is a chemical compound with the molecular formula C12H18O and a molecular weight of 181.29 g/mol. IUPAC name: 1-(1-adamantyl)-2,2,2-trideuterioethanone. InChIKey: DACIGVIOAFXPHW-FIBGUPNXSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 181.29 g/mol |
| IUPAC name | 1-(1-adamantyl)-2,2,2-trideuterioethanone |
| InChIKey | DACIGVIOAFXPHW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)