CAS 1803587-60-1 is the registry number for 2,2,2-Trifluoroethyl pyridine-3-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2,2,2-trifluoroethyl pyridine-3-carboxylate;hydrochloride (CAS 1803587-60-1) is a chemical compound with the molecular formula C8H7ClF3NO2 and a molecular weight of 241.59 g/mol. IUPAC name: 2,2,2-trifluoroethyl pyridine-3-carboxylate;hydrochloride. InChIKey: KEDJNJNDQLFUQD-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO2 |
|---|---|
| Molecular weight | 241.59 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl pyridine-3-carboxylate;hydrochloride |
| InChIKey | KEDJNJNDQLFUQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)OCC(F)(F)F.Cl |
Computed by PubChem (NCBI)