Products 1803587-60-1

CAS 1803587-60-1 is the registry number for 2,2,2-Trifluoroethyl pyridine-3-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

2,2,2-trifluoroethyl pyridine-3-carboxylate;hydrochloride (CAS 1803587-60-1) is a chemical compound with the molecular formula C8H7ClF3NO2 and a molecular weight of 241.59 g/mol. IUPAC name: 2,2,2-trifluoroethyl pyridine-3-carboxylate;hydrochloride. InChIKey: KEDJNJNDQLFUQD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClF3NO2
Molecular weight241.59 g/mol
IUPAC name2,2,2-trifluoroethyl pyridine-3-carboxylate;hydrochloride
InChIKeyKEDJNJNDQLFUQD-UHFFFAOYSA-N
SMILESC1=CC(=CN=C1)C(=O)OCC(F)(F)F.Cl

Computed by PubChem (NCBI)