CAS 1280786-93-7 is the registry number for 1-(5-Bromo-2-fluorophenyl)pentan-1-one, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-(5-bromo-2-fluorophenyl)pentan-1-one (CAS 1280786-93-7) is a chemical compound with the molecular formula C11H12BrFO and a molecular weight of 259.11 g/mol. IUPAC name: 1-(5-bromo-2-fluorophenyl)pentan-1-one. InChIKey: NXVFHYRTBOEYBO-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO |
|---|---|
| Molecular weight | 259.11 g/mol |
| IUPAC name | 1-(5-bromo-2-fluorophenyl)pentan-1-one |
| InChIKey | NXVFHYRTBOEYBO-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)C1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)