Products 2921913-24-6
CAS 2921913-24-6 is the registry number for (E)-1-(6-bromo-2-fluoro-3-methylphenyl)but-2-en-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E)-1-(6-bromo-2-fluoro-3-methylphenyl)but-2-en-1-ol (CAS 2921913-24-6) is a chemical compound with the molecular formula C11H12BrFO and a molecular weight of 259.11 g/mol. IUPAC name: (E)-1-(6-bromo-2-fluoro-3-methylphenyl)but-2-en-1-ol. InChIKey: GEJHPCGAYICJGB-ONEGZZNKSA-N.
| Molecular formula | C11H12BrFO |
|---|---|
| Molecular weight | 259.11 g/mol |
| IUPAC name | (E)-1-(6-bromo-2-fluoro-3-methylphenyl)but-2-en-1-ol |
| InChIKey | GEJHPCGAYICJGB-ONEGZZNKSA-N |
| SMILES | C/C=C/C(C1=C(C=CC(=C1F)C)Br)O |
Computed by PubChem (NCBI)