CAS 1373350-56-1 is the registry number for 5-Bromo-1-(2-fluorophenyl)-2-pentanone. Offered by: TRC. Available pack sizes: 100mg, 1g.
5-bromo-1-(2-fluorophenyl)pentan-2-one (CAS 1373350-56-1) is a chemical compound with the molecular formula C11H12BrFO and a molecular weight of 259.11 g/mol. IUPAC name: 5-bromo-1-(2-fluorophenyl)pentan-2-one. InChIKey: JWOWGWXSDRIJDF-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO |
|---|---|
| Molecular weight | 259.11 g/mol |
| IUPAC name | 5-bromo-1-(2-fluorophenyl)pentan-2-one |
| InChIKey | JWOWGWXSDRIJDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)CCCBr)F |
Computed by PubChem (NCBI)