CAS 1280787-05-4 appears in our catalog under these names: (R)-3-((tert-Butoxycarbonyl)amino)-2-(4-chlorophenyl)propanoic acid, 98%, (R)-3-((tert-Butoxycarbonyl)amino)-2-(4-chlorophenyl)propanoic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: 50mg, 25mg, 100mg, 250mg, 1g.
(2R)-2-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1280787-05-4) is a chemical compound with the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. IUPAC name: (2R)-2-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RIGRQUWZTOVESX-NSHDSACASA-N.
| Molecular formula | C14H18ClNO4 |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | (2R)-2-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RIGRQUWZTOVESX-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)