CAS 683218-90-8 appears in our catalog under these names: 3-{((tert-Butoxy)carbonyl)amino}-2-(4-chlorophenyl)propanoic acid, 3-((tert-Butoxycarbonyl)amino)-2-(4-chlorophenyl)propanoic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 683218-90-8) is a chemical compound with the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. IUPAC name: 2-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RIGRQUWZTOVESX-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO4 |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RIGRQUWZTOVESX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)