CAS 1280787-22-5 is the registry number for Ethyl 2-(methylamino)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 2-(methylamino)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate (CAS 1280787-22-5) is a chemical compound with the molecular formula C8H9F3N2O2S and a molecular weight of 254.23 g/mol. IUPAC name: ethyl 2-(methylamino)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate. InChIKey: NXYDYIPUUQMSDN-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O2S |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | ethyl 2-(methylamino)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
| InChIKey | NXYDYIPUUQMSDN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)NC)C(F)(F)F |
Computed by PubChem (NCBI)