Products 1380201-88-6
CAS 1380201-88-6 is the registry number for AND-302. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[1,1-difluoro-2-(sulfamoylamino)ethyl]-2-fluorobenzene (CAS 1380201-88-6) is a chemical compound with the molecular formula C8H9F3N2O2S and a molecular weight of 254.23 g/mol. IUPAC name: 1-[1,1-difluoro-2-(sulfamoylamino)ethyl]-2-fluorobenzene. InChIKey: HTVBDYJYWBEYPB-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O2S |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | 1-[1,1-difluoro-2-(sulfamoylamino)ethyl]-2-fluorobenzene |
| InChIKey | HTVBDYJYWBEYPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CNS(=O)(=O)N)(F)F)F |
Computed by PubChem (NCBI)