CAS 1306606-07-4 is the registry number for 2,2,2-Trifluoroethyl N-(dimethyl-1,3-thiazol-2-yl)carbamate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,2,2-trifluoroethyl N-(4,5-dimethyl-1,3-thiazol-2-yl)carbamate (CAS 1306606-07-4) is a chemical compound with the molecular formula C8H9F3N2O2S and a molecular weight of 254.23 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(4,5-dimethyl-1,3-thiazol-2-yl)carbamate. InChIKey: UKSKKBFNTLJYFK-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O2S |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(4,5-dimethyl-1,3-thiazol-2-yl)carbamate |
| InChIKey | UKSKKBFNTLJYFK-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)OCC(F)(F)F)C |
Computed by PubChem (NCBI)