Products 1280882-69-0
CAS 1280882-69-0 is the registry number for 2-((4-Bromo-2-nitrophenyl)(methyl)amino)-N,N-dimethylacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromo-N-methyl-2-nitroanilino)-N,N-dimethylacetamide (CAS 1280882-69-0) is a chemical compound with the molecular formula C11H14BrN3O3 and a molecular weight of 316.15 g/mol. IUPAC name: 2-(4-bromo-N-methyl-2-nitroanilino)-N,N-dimethylacetamide. InChIKey: AAMQOFBSKQQGOU-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O3 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 2-(4-bromo-N-methyl-2-nitroanilino)-N,N-dimethylacetamide |
| InChIKey | AAMQOFBSKQQGOU-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CN(C)C1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)