Products 1356620-53-5
CAS 1356620-53-5 is the registry number for 2-((3-Bromo-4-methoxyphenyl)amino)-N-carbamoylpropanamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromo-4-methoxyanilino)-N-carbamoylpropanamide (CAS 1356620-53-5) is a chemical compound with the molecular formula C11H14BrN3O3 and a molecular weight of 316.15 g/mol. IUPAC name: 2-(3-bromo-4-methoxyanilino)-N-carbamoylpropanamide. InChIKey: SOBYUMFDBXSSKF-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O3 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 2-(3-bromo-4-methoxyanilino)-N-carbamoylpropanamide |
| InChIKey | SOBYUMFDBXSSKF-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC(=O)N)NC1=CC(=C(C=C1)OC)Br |
Computed by PubChem (NCBI)