CAS 1401983-71-8 is the registry number for tert-Butyl 1-bromo-5-oxo-7,8-dihydroimidazo(1,5-c)pyrimidine-6(5H)-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl 1-bromo-5-oxo-7,8-dihydroimidazo[1,5-c]pyrimidine-6-carboxylate (CAS 1401983-71-8) is a chemical compound with the molecular formula C11H14BrN3O3 and a molecular weight of 316.15 g/mol. IUPAC name: tert-butyl 1-bromo-5-oxo-7,8-dihydroimidazo[1,5-c]pyrimidine-6-carboxylate. InChIKey: CWXPTQVTNMTGJQ-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3O3 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | tert-butyl 1-bromo-5-oxo-7,8-dihydroimidazo[1,5-c]pyrimidine-6-carboxylate |
| InChIKey | CWXPTQVTNMTGJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(N=CN2C1=O)Br |
Computed by PubChem (NCBI)