Products 1280945-92-7
CAS 1280945-92-7 is the registry number for 4-(2-Chloroallyl)-3-(methylsulfonyl)-4H-1,2,4-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-chloroprop-2-enyl)-3-methylsulfonyl-1,2,4-triazole (CAS 1280945-92-7) is a chemical compound with the molecular formula C6H8ClN3O2S and a molecular weight of 221.67 g/mol. IUPAC name: 4-(2-chloroprop-2-enyl)-3-methylsulfonyl-1,2,4-triazole. InChIKey: FUSORUGVNVFADQ-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN3O2S |
|---|---|
| Molecular weight | 221.67 g/mol |
| IUPAC name | 4-(2-chloroprop-2-enyl)-3-methylsulfonyl-1,2,4-triazole |
| InChIKey | FUSORUGVNVFADQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NN=CN1CC(=C)Cl |
Computed by PubChem (NCBI)