CAS 1956364-23-0 is the registry number for 2-Amino-5,7-dihydrothieno[3,4-d]pyrimidine 6,6-dioxide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6,6-dioxo-5,7-dihydrothieno[3,4-d]pyrimidin-2-amine;hydrochloride (CAS 1956364-23-0) is a chemical compound with the molecular formula C6H8ClN3O2S and a molecular weight of 221.67 g/mol. IUPAC name: 6,6-dioxo-5,7-dihydrothieno[3,4-d]pyrimidin-2-amine;hydrochloride. InChIKey: CZOVYKMRRCTAEC-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN3O2S |
|---|---|
| Molecular weight | 221.67 g/mol |
| IUPAC name | 6,6-dioxo-5,7-dihydrothieno[3,4-d]pyrimidin-2-amine;hydrochloride |
| InChIKey | CZOVYKMRRCTAEC-UHFFFAOYSA-N |
| SMILES | C1C2=CN=C(N=C2CS1(=O)=O)N.Cl |
Computed by PubChem (NCBI)