Products 2819971-25-8

CAS 2819971-25-8 is the registry number for 3-(Dimethylamino)pyrazine-2-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(dimethylamino)pyrazine-2-sulfonyl chloride (CAS 2819971-25-8) is a chemical compound with the molecular formula C6H8ClN3O2S and a molecular weight of 221.67 g/mol. IUPAC name: 3-(dimethylamino)pyrazine-2-sulfonyl chloride. InChIKey: AZXVZGYEZJYWHD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClN3O2S
Molecular weight221.67 g/mol
IUPAC name3-(dimethylamino)pyrazine-2-sulfonyl chloride
InChIKeyAZXVZGYEZJYWHD-UHFFFAOYSA-N
SMILESCN(C)C1=NC=CN=C1S(=O)(=O)Cl

Computed by PubChem (NCBI)