CAS 1281081-32-0 is the registry number for LC3B recruiter 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-chloro-3-(pyridin-4-ylmethyl)-1H-quinazoline-2,4-dione (CAS 1281081-32-0) is a chemical compound with the molecular formula C14H10ClN3O2 and a molecular weight of 287.70 g/mol. IUPAC name: 7-chloro-3-(pyridin-4-ylmethyl)-1H-quinazoline-2,4-dione. InChIKey: ROBFUOZPICQRIL-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3O2 |
|---|---|
| Molecular weight | 287.70 g/mol |
| IUPAC name | 7-chloro-3-(pyridin-4-ylmethyl)-1H-quinazoline-2,4-dione |
| InChIKey | ROBFUOZPICQRIL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=O)N(C2=O)CC3=CC=NC=C3 |
Computed by PubChem (NCBI)