Products 1281081-32-0

CAS 1281081-32-0 is the registry number for LC3B recruiter 1. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

7-chloro-3-(pyridin-4-ylmethyl)-1H-quinazoline-2,4-dione (CAS 1281081-32-0) is a chemical compound with the molecular formula C14H10ClN3O2 and a molecular weight of 287.70 g/mol. IUPAC name: 7-chloro-3-(pyridin-4-ylmethyl)-1H-quinazoline-2,4-dione. InChIKey: ROBFUOZPICQRIL-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10ClN3O2
Molecular weight287.70 g/mol
IUPAC name7-chloro-3-(pyridin-4-ylmethyl)-1H-quinazoline-2,4-dione
InChIKeyROBFUOZPICQRIL-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Cl)NC(=O)N(C2=O)CC3=CC=NC=C3

Computed by PubChem (NCBI)

Synonyms: orb2945567