Products 1281121-55-8
CAS 1281121-55-8 is the registry number for N-(tert-Butyl)-1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-tert-butyl-1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxamide (CAS 1281121-55-8) is a chemical compound with the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. IUPAC name: N-tert-butyl-1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxamide. InChIKey: JCQJKFAYDOFERZ-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | N-tert-butyl-1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carboxamide |
| InChIKey | JCQJKFAYDOFERZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1CC(=O)N(C1)CC2CC2 |
Computed by PubChem (NCBI)