Products 1281360-81-3
CAS 1281360-81-3 is the registry number for (S)-2-(5-Bromonicotinamido)-3,3-dimethylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(5-bromopyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid (CAS 1281360-81-3) is a chemical compound with the molecular formula C12H15BrN2O3 and a molecular weight of 315.16 g/mol. IUPAC name: (2S)-2-[(5-bromopyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid. InChIKey: KPPXCAVLNBNFRW-SECBINFHSA-N.
| Molecular formula | C12H15BrN2O3 |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | (2S)-2-[(5-bromopyridine-3-carbonyl)amino]-3,3-dimethylbutanoic acid |
| InChIKey | KPPXCAVLNBNFRW-SECBINFHSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)