CAS 1350738-76-9 is the registry number for tert-Butyl 7-bromo-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-bromo-2,3-dihydropyrido[3,4-b][1,4]oxazine-1-carboxylate (CAS 1350738-76-9) is a chemical compound with the molecular formula C12H15BrN2O3 and a molecular weight of 315.16 g/mol. IUPAC name: tert-butyl 7-bromo-2,3-dihydropyrido[3,4-b][1,4]oxazine-1-carboxylate. InChIKey: VXYJFGHODMBIKR-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O3 |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | tert-butyl 7-bromo-2,3-dihydropyrido[3,4-b][1,4]oxazine-1-carboxylate |
| InChIKey | VXYJFGHODMBIKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=CN=C(C=C21)Br |
Computed by PubChem (NCBI)