CAS 953726-14-2 appears in our catalog under these names: 2-(([(3-Bromophenyl)methyl]carbamoyl)amino)-2-methylpropanoic acid, 95%, 2-({((3-bromophenyl)methyl)carbamoyl}amino)-2-methylpropanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 100mg, 1g.
2-[(3-bromophenyl)methylcarbamoylamino]-2-methylpropanoic acid (CAS 953726-14-2) is a chemical compound with the molecular formula C12H15BrN2O3 and a molecular weight of 315.16 g/mol. IUPAC name: 2-[(3-bromophenyl)methylcarbamoylamino]-2-methylpropanoic acid. InChIKey: XEMBSINYRNZZLY-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O3 |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | 2-[(3-bromophenyl)methylcarbamoylamino]-2-methylpropanoic acid |
| InChIKey | XEMBSINYRNZZLY-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NC(=O)NCC1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)