Products 1281486-93-8
CAS 1281486-93-8 appears in our catalog under these names: 2-methyl-3-[4-(trifluoromethoxy)phenyl]propanoic acid, 95%, 2-Methyl-3-(4-(trifluoromethoxy)phenyl)propanoic acid, 95%, 2-Methyl-3-(4-(trifluoromethoxy)phenyl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
2-methyl-3-[4-(trifluoromethoxy)phenyl]propanoic acid (CAS 1281486-93-8) is a chemical compound with the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. IUPAC name: 2-methyl-3-[4-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: MRVJHZZQDZTGDM-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O3 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | 2-methyl-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | MRVJHZZQDZTGDM-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)