Products 87411-31-2
CAS 87411-31-2 appears in our catalog under these names: 4-(3-Trifluoromethyl-phenoxy)-butyric acid, 95%, 4-(3-Trifluoromethyl-phenoxy)-butyric acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 1000mg.
4-[3-(trifluoromethyl)phenoxy]butanoic acid (CAS 87411-31-2) is a chemical compound with the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenoxy]butanoic acid. InChIKey: BROOMGSHOWKNNX-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O3 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenoxy]butanoic acid |
| InChIKey | BROOMGSHOWKNNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCCCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)