Products 26002-48-2
CAS 26002-48-2 appears in our catalog under these names: 2-Methyl-2-(4-(trifluoromethyl)phenoxy)propanoic acid, 2-Methyl-2-(4-(trifluoromethyl)phenoxy)propanoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 50mg, 0,5g, 250mg, 1g.
2-methyl-2-[4-(trifluoromethyl)phenoxy]propanoic acid (CAS 26002-48-2) is a chemical compound with the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. IUPAC name: 2-methyl-2-[4-(trifluoromethyl)phenoxy]propanoic acid. InChIKey: PYSRGMCGNCBXSF-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O3 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | 2-methyl-2-[4-(trifluoromethyl)phenoxy]propanoic acid |
| InChIKey | PYSRGMCGNCBXSF-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)