CAS 128172-84-9 appears in our catalog under these names: 1-[4-(methylsulfanyl)phenyl]butane-1,3-dione, 98%, 98%, 3-hydroxy-1-[4-(methylsulfanyl)phenyl]but-2-en-1-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
1-(4-methylsulfanylphenyl)butane-1,3-dione (CAS 128172-84-9) is a chemical compound with the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. IUPAC name: 1-(4-methylsulfanylphenyl)butane-1,3-dione. InChIKey: NXSPDZUATWHWKH-UHFFFAOYSA-N.
| Molecular formula | C11H12O2S |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | 1-(4-methylsulfanylphenyl)butane-1,3-dione |
| InChIKey | NXSPDZUATWHWKH-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)SC |
Computed by PubChem (NCBI)