Products 1281905-04-1
CAS 1281905-04-1 is the registry number for 2-Chloro-3-((2,3-dichlorophenoxy)methyl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-3-[(2,3-dichlorophenoxy)methyl]pyridine (CAS 1281905-04-1) is a chemical compound with the molecular formula C12H8Cl3NO and a molecular weight of 288.6 g/mol. IUPAC name: 2-chloro-3-[(2,3-dichlorophenoxy)methyl]pyridine. InChIKey: MCYJLXKAIKYCCL-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl3NO |
|---|---|
| Molecular weight | 288.6 g/mol |
| IUPAC name | 2-chloro-3-[(2,3-dichlorophenoxy)methyl]pyridine |
| InChIKey | MCYJLXKAIKYCCL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OCC2=C(N=CC=C2)Cl |
Computed by PubChem (NCBI)