CAS 56966-58-6 is the registry number for 3-Chloro-4-(2,4-dichlorophenoxy)benzenamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
3-chloro-4-(2,4-dichlorophenoxy)aniline (CAS 56966-58-6) is a chemical compound with the molecular formula C12H8Cl3NO and a molecular weight of 288.6 g/mol. IUPAC name: 3-chloro-4-(2,4-dichlorophenoxy)aniline. InChIKey: JGFOIVLPTZNBQC-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl3NO |
|---|---|
| Molecular weight | 288.6 g/mol |
| IUPAC name | 3-chloro-4-(2,4-dichlorophenoxy)aniline |
| InChIKey | JGFOIVLPTZNBQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)