CAS 26306-61-6 is the registry number for Chlornitrofen-amino 100 µg/mL in Cyclohexane. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
4-(2,4,6-trichlorophenoxy)aniline (CAS 26306-61-6) is a chemical compound with the molecular formula C12H8Cl3NO and a molecular weight of 288.6 g/mol. IUPAC name: 4-(2,4,6-trichlorophenoxy)aniline. InChIKey: YDIXMXKRLYKJJM-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl3NO |
|---|---|
| Molecular weight | 288.6 g/mol |
| IUPAC name | 4-(2,4,6-trichlorophenoxy)aniline |
| InChIKey | YDIXMXKRLYKJJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=C(C=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)