Products 26306-61-6

CAS 26306-61-6 is the registry number for Chlornitrofen-amino 100 µg/mL in Cyclohexane. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.

Structural formula: {0} (CAS {1})

4-(2,4,6-trichlorophenoxy)aniline (CAS 26306-61-6) is a chemical compound with the molecular formula C12H8Cl3NO and a molecular weight of 288.6 g/mol. IUPAC name: 4-(2,4,6-trichlorophenoxy)aniline. InChIKey: YDIXMXKRLYKJJM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8Cl3NO
Molecular weight288.6 g/mol
IUPAC name4-(2,4,6-trichlorophenoxy)aniline
InChIKeyYDIXMXKRLYKJJM-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N)OC2=C(C=C(C=C2Cl)Cl)Cl

Computed by PubChem (NCBI)