Products 1282168-51-7

CAS 1282168-51-7 is the registry number for 1-[(4-Bromophenyl)carbamoyl]cyclobutane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-[(4-bromophenyl)carbamoyl]cyclobutane-1-carboxylic acid (CAS 1282168-51-7) is a chemical compound with the molecular formula C12H12BrNO3 and a molecular weight of 298.13 g/mol. IUPAC name: 1-[(4-bromophenyl)carbamoyl]cyclobutane-1-carboxylic acid. InChIKey: MZWUIDHFGTYJDE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12BrNO3
Molecular weight298.13 g/mol
IUPAC name1-[(4-bromophenyl)carbamoyl]cyclobutane-1-carboxylic acid
InChIKeyMZWUIDHFGTYJDE-UHFFFAOYSA-N
SMILESC1CC(C1)(C(=O)NC2=CC=C(C=C2)Br)C(=O)O

Computed by PubChem (NCBI)