Products 145764-04-1
CAS 145764-04-1 appears in our catalog under these names: 1-[(4-Bromophenyl)carbonyl]pyrrolidine-2-carboxylic acid, 95%, (4-Bromobenzoyl)proline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
1-(4-bromobenzoyl)pyrrolidine-2-carboxylic acid (CAS 145764-04-1) is a chemical compound with the molecular formula C12H12BrNO3 and a molecular weight of 298.13 g/mol. IUPAC name: 1-(4-bromobenzoyl)pyrrolidine-2-carboxylic acid. InChIKey: URXUXNFNMXRTAJ-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO3 |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | 1-(4-bromobenzoyl)pyrrolidine-2-carboxylic acid |
| InChIKey | URXUXNFNMXRTAJ-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)