Products 1415819-90-7
CAS 1415819-90-7 is the registry number for Ethyl 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
Ethyl 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate (CAS 1415819-90-7) is a chemical compound with the molecular formula C12H12BrNO3 and a molecular weight of 298.13 g/mol. IUPAC name: ethyl 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate. InChIKey: MVXFSCSRUAJVRJ-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO3 |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | ethyl 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate |
| InChIKey | MVXFSCSRUAJVRJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(C=C(C=C2)Br)NC1=O |
Computed by PubChem (NCBI)