Products 1282513-75-0
CAS 1282513-75-0 appears in our catalog under these names: 4'–Methyl–β–naphthoflavone, 4'-Methyl-β-naphthoflavone, 99%, 99%, 4'-Methyl-β-naphthoflavone, 99.88%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 5 mg, 100 mg, 25 mg.
3-(4-methylphenyl)benzo[f]chromen-1-one (CAS 1282513-75-0) is a chemical compound with the molecular formula C20H14O2 and a molecular weight of 286.3 g/mol. IUPAC name: 3-(4-methylphenyl)benzo[f]chromen-1-one. InChIKey: RCJBVSDMTQRCFC-UHFFFAOYSA-N.
| Molecular formula | C20H14O2 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 3-(4-methylphenyl)benzo[f]chromen-1-one |
| InChIKey | RCJBVSDMTQRCFC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)