Products 1282549-93-2

CAS 1282549-93-2 is the registry number for 3,5-dimethoxy-4-(methoxymethyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

3,5-dimethoxy-4-(methoxymethyl)benzoic acid (CAS 1282549-93-2) is a chemical compound with the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. IUPAC name: 3,5-dimethoxy-4-(methoxymethyl)benzoic acid. InChIKey: NOLUDIYQCJRYCR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O5
Molecular weight226.23 g/mol
IUPAC name3,5-dimethoxy-4-(methoxymethyl)benzoic acid
InChIKeyNOLUDIYQCJRYCR-UHFFFAOYSA-N
SMILESCOCC1=C(C=C(C=C1OC)C(=O)O)OC

Computed by PubChem (NCBI)