Products 1282763-59-0
CAS 1282763-59-0 is the registry number for 6-Oxo-1-{(2-(propan-2-yl)-1,3-thiazol-4-yl)methyl}-1,6-dihydropyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-oxo-1-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]pyridine-3-carboxylic acid (CAS 1282763-59-0) is a chemical compound with the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. IUPAC name: 6-oxo-1-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]pyridine-3-carboxylic acid. InChIKey: NSULXCGRVQKOQQ-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3S |
|---|---|
| Molecular weight | 278.33 g/mol |
| IUPAC name | 6-oxo-1-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]pyridine-3-carboxylic acid |
| InChIKey | NSULXCGRVQKOQQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=CS1)CN2C=C(C=CC2=O)C(=O)O |
Computed by PubChem (NCBI)