CAS 128311-08-0 appears in our catalog under these names: (S)–4–Chloro–N–(quinuclidin–3–yl)benzamide hydrochloride, PNU-282987 S enantiomer hydrochloride, (S)-PNU-282987 (hydrochloride). Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 5mg, 25mg, 50mg, 100mg, Get quote.
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-4-chlorobenzamide;hydrochloride (CAS 128311-08-0) is a chemical compound with the molecular formula C14H18Cl2N2O and a molecular weight of 301.2 g/mol. IUPAC name: N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-4-chlorobenzamide;hydrochloride. InChIKey: HSEQUIRZHDYOIX-BTQNPOSSSA-N.
| Molecular formula | C14H18Cl2N2O |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-4-chlorobenzamide;hydrochloride |
| InChIKey | HSEQUIRZHDYOIX-BTQNPOSSSA-N |
| SMILES | C1CN2CCC1[C@@H](C2)NC(=O)C3=CC=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)