Products 1580956-92-8
CAS 1580956-92-8 appears in our catalog under these names: N,N–didesmethyl AH 7921, N,N-didesmethyl AH 7921. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
N-[(1-aminocyclohexyl)methyl]-3,4-dichlorobenzamide (CAS 1580956-92-8) is a chemical compound with the molecular formula C14H18Cl2N2O and a molecular weight of 301.2 g/mol. IUPAC name: N-[(1-aminocyclohexyl)methyl]-3,4-dichlorobenzamide. InChIKey: LOONJCCUJYOMJH-UHFFFAOYSA-N.
| Molecular formula | C14H18Cl2N2O |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | N-[(1-aminocyclohexyl)methyl]-3,4-dichlorobenzamide |
| InChIKey | LOONJCCUJYOMJH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(CNC(=O)C2=CC(=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)