CAS 1337880-30-4 is the registry number for 2-(6-(P-Tolyloxy)pyridin-3-yl)ethanamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
2-[6-(4-methylphenoxy)-3-pyridinyl]ethanamine;dihydrochloride (CAS 1337880-30-4) is a chemical compound with the molecular formula C14H18Cl2N2O and a molecular weight of 301.2 g/mol. IUPAC name: 2-[6-(4-methylphenoxy)-3-pyridinyl]ethanamine;dihydrochloride. InChIKey: LJIHDXUUIMMFLI-UHFFFAOYSA-N.
| Molecular formula | C14H18Cl2N2O |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | 2-[6-(4-methylphenoxy)-3-pyridinyl]ethanamine;dihydrochloride |
| InChIKey | LJIHDXUUIMMFLI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=NC=C(C=C2)CCN.Cl.Cl |
Computed by PubChem (NCBI)