CAS 1283575-48-3 is the registry number for 1-(4-Bromophenyl)-N-((3,5-dimethylisoxazol-4-yl)methyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromophenyl)-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]ethanamine (CAS 1283575-48-3) is a chemical compound with the molecular formula C14H17BrN2O and a molecular weight of 309.20 g/mol. IUPAC name: 1-(4-bromophenyl)-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]ethanamine. InChIKey: FMYASFLGCREJNK-UHFFFAOYSA-N.
| Molecular formula | C14H17BrN2O |
|---|---|
| Molecular weight | 309.20 g/mol |
| IUPAC name | 1-(4-bromophenyl)-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]ethanamine |
| InChIKey | FMYASFLGCREJNK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CNC(C)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)