CAS 2070009-47-9 is the registry number for 1H-Indole-3-methanol, 5-bromo-α-[(2R)-1-methyl-2-pyrrolidinyl]-, (αS)-, 98%, 98%. Offered by: Chemat. Available pack sizes: 25mg, 100mg.
(S)-(5-bromo-1H-indol-3-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanol (CAS 2070009-47-9) is a chemical compound with the molecular formula C14H17BrN2O and a molecular weight of 309.20 g/mol. IUPAC name: (S)-(5-bromo-1H-indol-3-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanol. InChIKey: HTOSGRDNJROXTF-KGLIPLIRSA-N.
| Molecular formula | C14H17BrN2O |
|---|---|
| Molecular weight | 309.20 g/mol |
| IUPAC name | (S)-(5-bromo-1H-indol-3-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanol |
| InChIKey | HTOSGRDNJROXTF-KGLIPLIRSA-N |
| SMILES | CN1CCC[C@@H]1[C@H](C2=CNC3=C2C=C(C=C3)Br)O |
Computed by PubChem (NCBI)