CAS 53616-28-7 is the registry number for 5-(Bromomethyl)-4-isopropyl-1-methyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one. Offered by: TRC. Available pack sizes: 250mg.
5-(bromomethyl)-1-methyl-2-phenyl-4-propan-2-ylpyrazol-3-one (CAS 53616-28-7) is a chemical compound with the molecular formula C14H17BrN2O and a molecular weight of 309.20 g/mol. IUPAC name: 5-(bromomethyl)-1-methyl-2-phenyl-4-propan-2-ylpyrazol-3-one. InChIKey: XBESMQIHFLWKGS-UHFFFAOYSA-N.
| Molecular formula | C14H17BrN2O |
|---|---|
| Molecular weight | 309.20 g/mol |
| IUPAC name | 5-(bromomethyl)-1-methyl-2-phenyl-4-propan-2-ylpyrazol-3-one |
| InChIKey | XBESMQIHFLWKGS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N(N(C1=O)C2=CC=CC=C2)C)CBr |
Computed by PubChem (NCBI)