Products 128396-56-5

CAS 128396-56-5 is the registry number for Ziprasidone Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-piperazin-1-yl-1,2-benzothiazole 1-oxide (CAS 128396-56-5) is a chemical compound with the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. IUPAC name: 3-piperazin-1-yl-1,2-benzothiazole 1-oxide. InChIKey: MOBIZCKXBZKGFC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13N3OS
Molecular weight235.31 g/mol
IUPAC name3-piperazin-1-yl-1,2-benzothiazole 1-oxide
InChIKeyMOBIZCKXBZKGFC-UHFFFAOYSA-N
SMILESC1CN(CCN1)C2=NS(=O)C3=CC=CC=C32

Computed by PubChem (NCBI)