CAS 128396-56-5 is the registry number for Ziprasidone Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
3-piperazin-1-yl-1,2-benzothiazole 1-oxide (CAS 128396-56-5) is a chemical compound with the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. IUPAC name: 3-piperazin-1-yl-1,2-benzothiazole 1-oxide. InChIKey: MOBIZCKXBZKGFC-UHFFFAOYSA-N.
| Molecular formula | C11H13N3OS |
|---|---|
| Molecular weight | 235.31 g/mol |
| IUPAC name | 3-piperazin-1-yl-1,2-benzothiazole 1-oxide |
| InChIKey | MOBIZCKXBZKGFC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NS(=O)C3=CC=CC=C32 |
Computed by PubChem (NCBI)