CAS 1284831-50-0 is the registry number for 2,2,2-Trifluoro-1-(4-methoxynaphthalen-1-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethanol (CAS 1284831-50-0) is a chemical compound with the molecular formula C13H11F3O2 and a molecular weight of 256.22 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethanol. InChIKey: GHAFRHFQJWOTRW-UHFFFAOYSA-N.
| Molecular formula | C13H11F3O2 |
|---|---|
| Molecular weight | 256.22 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethanol |
| InChIKey | GHAFRHFQJWOTRW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C2=CC=CC=C21)C(C(F)(F)F)O |
Computed by PubChem (NCBI)