CAS 2077118-04-6 appears in our catalog under these names: 3-(4-(TRIFLUOROMETHYL)PHENYL)BICYCLO(1.1.1)PENTANE-1-CARBOXYLIC ACID, 98%, 3-[4-(Trifluoromethyl)phenyl]bicyclo[1.1.1]pentane-1-carboxylic Acid, >97%, >97%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 50mg, 100mg, 1g.
3-[4-(trifluoromethyl)phenyl]bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2077118-04-6) is a chemical compound with the molecular formula C13H11F3O2 and a molecular weight of 256.22 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: AZQIUGFFJQTUEE-UHFFFAOYSA-N.
| Molecular formula | C13H11F3O2 |
|---|---|
| Molecular weight | 256.22 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | AZQIUGFFJQTUEE-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)