CAS 55579-69-6 appears in our catalog under these names: 5-[4-(Trifluoromethyl)phenyl]cyclohexane-1,3-dione, 98%, 3-Hydroxy-5-(4-trifluoromethyl-phenyl)-cyclohex-2-enone, 95%, 5-[4-(Trifluoromethyl)phenyl]cyclohexane-1,3-dione, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
5-[4-(trifluoromethyl)phenyl]cyclohexane-1,3-dione (CAS 55579-69-6) is a chemical compound with the molecular formula C13H11F3O2 and a molecular weight of 256.22 g/mol. IUPAC name: 5-[4-(trifluoromethyl)phenyl]cyclohexane-1,3-dione. InChIKey: HBUZHLJGLPSVNC-UHFFFAOYSA-N.
| Molecular formula | C13H11F3O2 |
|---|---|
| Molecular weight | 256.22 g/mol |
| IUPAC name | 5-[4-(trifluoromethyl)phenyl]cyclohexane-1,3-dione |
| InChIKey | HBUZHLJGLPSVNC-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)CC1=O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)