CAS 1284857-69-7 appears in our catalog under these names: 2-{2-((3-fluorophenyl)amino)ethyl}-1,2-thiazolidine-1,1-dione, 95%, 2-{2-((3-Fluorophenyl)amino)ethyl}-1,2-thiazolidine-1,1-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-fluoroaniline (CAS 1284857-69-7) is a chemical compound with the molecular formula C11H15FN2O2S and a molecular weight of 258.31 g/mol. IUPAC name: N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-fluoroaniline. InChIKey: HPHZXGSFIBYAQP-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2S |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-fluoroaniline |
| InChIKey | HPHZXGSFIBYAQP-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)CCNC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)