CAS 845616-10-6 appears in our catalog under these names: 1-(2-Fluoro-4-(methylsulfonyl)phenyl)piperazine, 98%, 98%, 1-[2-Fluoro-4-(methylsulfonyl)phenyl]piperazine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(2-fluoro-4-methylsulfonylphenyl)piperazine (CAS 845616-10-6) is a chemical compound with the molecular formula C11H15FN2O2S and a molecular weight of 258.31 g/mol. IUPAC name: 1-(2-fluoro-4-methylsulfonylphenyl)piperazine. InChIKey: CMYAOPCJWBOQNZ-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2S |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 1-(2-fluoro-4-methylsulfonylphenyl)piperazine |
| InChIKey | CMYAOPCJWBOQNZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)N2CCNCC2)F |
Computed by PubChem (NCBI)