CAS 901273-40-3 appears in our catalog under these names: 1-(4-Fluorobenzenesulfonyl)-1,4-diazepane, 95%, 1-(4-Fluorobenzenesulfonyl)-1,4-diazepane. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(4-fluorophenyl)sulfonyl-1,4-diazepane (CAS 901273-40-3) is a chemical compound with the molecular formula C11H15FN2O2S and a molecular weight of 258.31 g/mol. IUPAC name: 1-(4-fluorophenyl)sulfonyl-1,4-diazepane. InChIKey: YRDIFWYHRMGHLI-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2S |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 1-(4-fluorophenyl)sulfonyl-1,4-diazepane |
| InChIKey | YRDIFWYHRMGHLI-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)S(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)