CAS 1285349-13-4 appears in our catalog under these names: 2-(2,4-Difluorophenyl)-1-(pyridin-3-yl)ethanone, 95+%, 2–(2,4–Difluorophenyl)–1–(pyridin–3–yl)ethanone. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
2-(2,4-difluorophenyl)-1-pyridin-3-ylethanone (CAS 1285349-13-4) is a chemical compound with the molecular formula C13H9F2NO and a molecular weight of 233.21 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-1-pyridin-3-ylethanone. InChIKey: HOTTZHUFRMDHMA-UHFFFAOYSA-N.
| Molecular formula | C13H9F2NO |
|---|---|
| Molecular weight | 233.21 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-1-pyridin-3-ylethanone |
| InChIKey | HOTTZHUFRMDHMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)CC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)