Products 52833-64-4
CAS 52833-64-4 appears in our catalog under these names: 2-Fluoro-N-(2-fluorophenyl)benzamide 95+%, N1-(2-fluorophenyl)-2-fluorobenzamide, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g.
2-fluoro-N-(2-fluorophenyl)benzamide (CAS 52833-64-4) is a chemical compound with the molecular formula C13H9F2NO and a molecular weight of 233.21 g/mol. IUPAC name: 2-fluoro-N-(2-fluorophenyl)benzamide. InChIKey: PDVDKAQLDCYOJI-UHFFFAOYSA-N.
| Molecular formula | C13H9F2NO |
|---|---|
| Molecular weight | 233.21 g/mol |
| IUPAC name | 2-fluoro-N-(2-fluorophenyl)benzamide |
| InChIKey | PDVDKAQLDCYOJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=CC=C2F)F |
Computed by PubChem (NCBI)