Products 201995-09-7
CAS 201995-09-7 is the registry number for Benzamide, N-(2,4-difluorophenyl)-, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
N-(2,4-difluorophenyl)benzamide (CAS 201995-09-7) is a chemical compound with the molecular formula C13H9F2NO and a molecular weight of 233.21 g/mol. IUPAC name: N-(2,4-difluorophenyl)benzamide. InChIKey: VCRHVVLBUJFAFJ-UHFFFAOYSA-N.
| Molecular formula | C13H9F2NO |
|---|---|
| Molecular weight | 233.21 g/mol |
| IUPAC name | N-(2,4-difluorophenyl)benzamide |
| InChIKey | VCRHVVLBUJFAFJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)